C22H20FN7OS — CID 57021646
2-[[6-fluoro-4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-1H-benzimidazol-2-yl]methyl]-3H-benzimidazole-5-carboximidamide (PubChem CID 57021646) has the molecular formula C22H20FN7OS and a molecular weight of 449.52 g/mol. Its IUPAC name is 2-[[6-fluoro-4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-1H-benzimidazol-2-yl]methyl]-3H-benzimidazole-5-carboximidamide.
| Compound Name | 2-[[6-fluoro-4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-1H-benzimidazol-2-yl]methyl]-3H-benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 57021646 |
| Molecular Formula | C22H20FN7OS |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 2-[[6-fluoro-4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-1H-benzimidazol-2-yl]methyl]-3H-benzimidazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2nc(Cc3nc4c(OCCc5scnc5C)cc(F)cc4[nH]3)[nH]c2c1 |
| InChI | InChI=1S/C22H20FN7OS/c1-11-18(32-10-26-11)4-5-31-17-8-13(23)7-16-21(17)30-20(29-16)9-19-27-14-3-2-12(22(24)25)6-15(14)28-19/h2-3,6-8,10H,4-5,9H2,1H3,(H3,24,25)(H,27,28)(H,29,30) |
| InChIKey | NCJWDVVIRABMMJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 129.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|