About hept-6-enyl prop-2-enoate
hept-6-enyl prop-2-enoate (PubChem CID 57021777) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is hept-6-enyl prop-2-enoate.
Molecular Properties
| Compound Name | hept-6-enyl prop-2-enoate |
| PubChem CID | 57021777 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | hept-6-enyl prop-2-enoate |
| SMILES | C=CCCCCCOC(=O)C=C |
| InChI | InChI=1S/C10H16O2/c1-3-5-6-7-8-9-12-10(11)4-2/h3-4H,1-2,5-9H2 |
| InChIKey | GXDKSWRZINJXRH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze hept-6-enyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-6-enyl prop-2-enoate?
The IUPAC name of hept-6-enyl prop-2-enoate (CID 57021777) is hept-6-enyl prop-2-enoate.
What is the SMILES notation for hept-6-enyl prop-2-enoate?
The canonical SMILES for hept-6-enyl prop-2-enoate is C=CCCCCCOC(=O)C=C.
What is the InChIKey of hept-6-enyl prop-2-enoate?
The InChIKey is GXDKSWRZINJXRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-3-5-6-7-8-9-12-10(11)4-2/h3-4H,1-2,5-9H2.
What are the key properties of hept-6-enyl prop-2-enoate?
hept-6-enyl prop-2-enoate has a molecular weight of 168.24 g/mol, XLogP of 2.46, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hept-6-enyl prop-2-enoate is sourced from PubChem (CID 57021777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).