About 2-(1-adamantyl)-1,3-diphenylpropane-1,3-dione
2-(1-adamantyl)-1,3-diphenylpropane-1,3-dione (PubChem CID 570219) has the molecular formula C25H26O2
and a molecular weight of 358.48 g/mol. Its IUPAC name is 2-(1-adamantyl)-1,3-diphenylpropane-1,3-dione.
Molecular Properties
| Compound Name | 2-(1-adamantyl)-1,3-diphenylpropane-1,3-dione |
| PubChem CID | 570219 |
| Molecular Formula | C25H26O2 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 2-(1-adamantyl)-1,3-diphenylpropane-1,3-dione |
| SMILES | O=C(c1ccccc1)C(C(=O)c1ccccc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H26O2/c26-23(20-7-3-1-4-8-20)22(24(27)21-9-5-2-6-10-21)25-14-17-11-18(15-25)13-19(12-17)16-25/h1-10,17-19,22H,11-16H2 |
| InChIKey | WIGOPLGXGUEKCE-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-adamantyl)-1,3-diphenylpropane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)-1,3-diphenylpropane-1,3-dione?
The IUPAC name of 2-(1-adamantyl)-1,3-diphenylpropane-1,3-dione (CID 570219) is 2-(1-adamantyl)-1,3-diphenylpropane-1,3-dione.
What is the SMILES notation for 2-(1-adamantyl)-1,3-diphenylpropane-1,3-dione?
The canonical SMILES for 2-(1-adamantyl)-1,3-diphenylpropane-1,3-dione is O=C(c1ccccc1)C(C(=O)c1ccccc1)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 2-(1-adamantyl)-1,3-diphenylpropane-1,3-dione?
The InChIKey is WIGOPLGXGUEKCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26O2/c26-23(20-7-3-1-4-8-20)22(24(27)21-9-5-2-6-10-21)25-14-17-11-18(15-25)13-19(12-17)16-25/h1-10,17-19,22H,11-16H2.
What are the key properties of 2-(1-adamantyl)-1,3-diphenylpropane-1,3-dione?
2-(1-adamantyl)-1,3-diphenylpropane-1,3-dione has a molecular weight of 358.48 g/mol, XLogP of 5.58, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)-1,3-diphenylpropane-1,3-dione is sourced from PubChem (CID 570219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).