C20H33N3O2 — CID 57021991
N-[(3R)-5,8-diamino-4-oxoundecan-3-yl]-2-(3-methylphenyl)acetamide (PubChem CID 57021991) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is N-[(3R)-5,8-diamino-4-oxoundecan-3-yl]-2-(3-methylphenyl)acetamide.
| Compound Name | N-[(3R)-5,8-diamino-4-oxoundecan-3-yl]-2-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 57021991 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | N-[(3R)-5,8-diamino-4-oxoundecan-3-yl]-2-(3-methylphenyl)acetamide |
| SMILES | CCCC(N)CCC(N)C(=O)[C@@H](CC)NC(=O)Cc1cccc(C)c1 |
| InChI | InChI=1S/C20H33N3O2/c1-4-7-16(21)10-11-17(22)20(25)18(5-2)23-19(24)13-15-9-6-8-14(3)12-15/h6,8-9,12,16-18H,4-5,7,10-11,13,21-22H2,1-3H3,(H,23,24)/t16?,17?,18-/m1/s1 |
| InChIKey | SCOBEBMGVJIWHV-DAWZGUTISA-N |
| XLogP | 2.24 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |