About (7-tert-butyl-6-hydroxy-2-methyl-3,4-dihydrochromen-2-yl) formate
(7-tert-butyl-6-hydroxy-2-methyl-3,4-dihydrochromen-2-yl) formate (PubChem CID 57022346) has the molecular formula C15H20O4
and a molecular weight of 264.32 g/mol. Its IUPAC name is (7-tert-butyl-6-hydroxy-2-methyl-3,4-dihydrochromen-2-yl) formate.
Molecular Properties
| Compound Name | (7-tert-butyl-6-hydroxy-2-methyl-3,4-dihydrochromen-2-yl) formate |
| PubChem CID | 57022346 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (7-tert-butyl-6-hydroxy-2-methyl-3,4-dihydrochromen-2-yl) formate |
| SMILES | CC1(OC=O)CCc2cc(O)c(C(C)(C)C)cc2O1 |
| InChI | InChI=1S/C15H20O4/c1-14(2,3)11-8-13-10(7-12(11)17)5-6-15(4,19-13)18-9-16/h7-9,17H,5-6H2,1-4H3 |
| InChIKey | MZFKZQDALHCAMR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (7-tert-butyl-6-hydroxy-2-methyl-3,4-dihydrochromen-2-yl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-tert-butyl-6-hydroxy-2-methyl-3,4-dihydrochromen-2-yl) formate?
The IUPAC name of (7-tert-butyl-6-hydroxy-2-methyl-3,4-dihydrochromen-2-yl) formate (CID 57022346) is (7-tert-butyl-6-hydroxy-2-methyl-3,4-dihydrochromen-2-yl) formate.
What is the SMILES notation for (7-tert-butyl-6-hydroxy-2-methyl-3,4-dihydrochromen-2-yl) formate?
The canonical SMILES for (7-tert-butyl-6-hydroxy-2-methyl-3,4-dihydrochromen-2-yl) formate is CC1(OC=O)CCc2cc(O)c(C(C)(C)C)cc2O1.
What is the InChIKey of (7-tert-butyl-6-hydroxy-2-methyl-3,4-dihydrochromen-2-yl) formate?
The InChIKey is MZFKZQDALHCAMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O4/c1-14(2,3)11-8-13-10(7-12(11)17)5-6-15(4,19-13)18-9-16/h7-9,17H,5-6H2,1-4H3.
What are the key properties of (7-tert-butyl-6-hydroxy-2-methyl-3,4-dihydrochromen-2-yl) formate?
(7-tert-butyl-6-hydroxy-2-methyl-3,4-dihydrochromen-2-yl) formate has a molecular weight of 264.32 g/mol, XLogP of 2.90, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-tert-butyl-6-hydroxy-2-methyl-3,4-dihydrochromen-2-yl) formate is sourced from PubChem (CID 57022346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).