C11H17ClN6OS — CID 57022519
S-[2-[[4-(but-2-enylamino)-6-chloro-1,3,5-triazin-2-yl]amino]ethyl] N-methylcarbamothioate (PubChem CID 57022519) has the molecular formula C11H17ClN6OS and a molecular weight of 316.82 g/mol. Its IUPAC name is S-[2-[[4-(but-2-enylamino)-6-chloro-1,3,5-triazin-2-yl]amino]ethyl] N-methylcarbamothioate.
| Compound Name | S-[2-[[4-(but-2-enylamino)-6-chloro-1,3,5-triazin-2-yl]amino]ethyl] N-methylcarbamothioate |
|---|---|
| PubChem CID | 57022519 |
| Molecular Formula | C11H17ClN6OS |
| Molecular Weight | 316.82 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | S-[2-[[4-(but-2-enylamino)-6-chloro-1,3,5-triazin-2-yl]amino]ethyl] N-methylcarbamothioate |
| SMILES | CC=CCNc1nc(Cl)nc(NCCSC(=O)NC)n1 |
| InChI | InChI=1S/C11H17ClN6OS/c1-3-4-5-14-9-16-8(12)17-10(18-9)15-6-7-20-11(19)13-2/h3-4H,5-7H2,1-2H3,(H,13,19)(H2,14,15,16,17,18) |
| InChIKey | KGJCOWREYQKHRY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.82 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|