About 8-chloro-2,2,4-trimethyl-1H-quinoline
8-chloro-2,2,4-trimethyl-1H-quinoline (PubChem CID 57023724) has the molecular formula C12H14ClN
and a molecular weight of 207.70 g/mol. Its IUPAC name is 8-chloro-2,2,4-trimethyl-1H-quinoline.
Molecular Properties
| Compound Name | 8-chloro-2,2,4-trimethyl-1H-quinoline |
| PubChem CID | 57023724 |
| Molecular Formula | C12H14ClN |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 8-chloro-2,2,4-trimethyl-1H-quinoline |
| SMILES | CC1=CC(C)(C)Nc2c(Cl)cccc21 |
| InChI | InChI=1S/C12H14ClN/c1-8-7-12(2,3)14-11-9(8)5-4-6-10(11)13/h4-7,14H,1-3H3 |
| InChIKey | OMWKZDJMMWLMNQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-chloro-2,2,4-trimethyl-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-2,2,4-trimethyl-1H-quinoline?
The IUPAC name of 8-chloro-2,2,4-trimethyl-1H-quinoline (CID 57023724) is 8-chloro-2,2,4-trimethyl-1H-quinoline.
What is the SMILES notation for 8-chloro-2,2,4-trimethyl-1H-quinoline?
The canonical SMILES for 8-chloro-2,2,4-trimethyl-1H-quinoline is CC1=CC(C)(C)Nc2c(Cl)cccc21.
What is the InChIKey of 8-chloro-2,2,4-trimethyl-1H-quinoline?
The InChIKey is OMWKZDJMMWLMNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN/c1-8-7-12(2,3)14-11-9(8)5-4-6-10(11)13/h4-7,14H,1-3H3.
What are the key properties of 8-chloro-2,2,4-trimethyl-1H-quinoline?
8-chloro-2,2,4-trimethyl-1H-quinoline has a molecular weight of 207.70 g/mol, XLogP of 3.95, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-2,2,4-trimethyl-1H-quinoline is sourced from PubChem (CID 57023724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).