About (1-propylcyclohexyl) 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate
(1-propylcyclohexyl) 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate (PubChem CID 57024165) has the molecular formula C22H29F3O2
and a molecular weight of 382.47 g/mol. Its IUPAC name is (1-propylcyclohexyl) 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (1-propylcyclohexyl) 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate |
| PubChem CID | 57024165 |
| Molecular Formula | C22H29F3O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (1-propylcyclohexyl) 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate |
| SMILES | CCCC1(OC(=O)C2(c3cc(F)c(F)c(F)c3)CCCCC2)CCCCC1 |
| InChI | InChI=1S/C22H29F3O2/c1-2-9-21(10-5-3-6-11-21)27-20(26)22(12-7-4-8-13-22)16-14-17(23)19(25)18(24)15-16/h14-15H,2-13H2,1H3 |
| InChIKey | BVSLEDRINYRZMS-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze (1-propylcyclohexyl) 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-propylcyclohexyl) 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate?
The IUPAC name of (1-propylcyclohexyl) 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate (CID 57024165) is (1-propylcyclohexyl) 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate.
What is the SMILES notation for (1-propylcyclohexyl) 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate?
The canonical SMILES for (1-propylcyclohexyl) 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate is CCCC1(OC(=O)C2(c3cc(F)c(F)c(F)c3)CCCCC2)CCCCC1.
What is the InChIKey of (1-propylcyclohexyl) 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate?
The InChIKey is BVSLEDRINYRZMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29F3O2/c1-2-9-21(10-5-3-6-11-21)27-20(26)22(12-7-4-8-13-22)16-14-17(23)19(25)18(24)15-16/h14-15H,2-13H2,1H3.
What are the key properties of (1-propylcyclohexyl) 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate?
(1-propylcyclohexyl) 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate has a molecular weight of 382.47 g/mol, XLogP of 6.35, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-propylcyclohexyl) 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 57024165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).