C7H8N4S6 — CID 57024362
5-[2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]propan-2-ylsulfanyl]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 57024362) has the molecular formula C7H8N4S6 and a molecular weight of 340.57 g/mol. Its IUPAC name is 5-[2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]propan-2-ylsulfanyl]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]propan-2-ylsulfanyl]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 57024362 |
| Molecular Formula | C7H8N4S6 |
| Molecular Weight | 340.57 g/mol |
| Exact Mass | 339.91 |
| IUPAC Name | 5-[2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]propan-2-ylsulfanyl]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CC(C)(Sc1n[nH]c(=S)s1)Sc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C7H8N4S6/c1-7(2,16-5-10-8-3(12)14-5)17-6-11-9-4(13)15-6/h1-2H3,(H,8,12)(H,9,13) |
| InChIKey | QXHIGTZMCHQMAT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|