C23H27NO2 — CID 57024577
ethyl 3-[4-(5-phenylhex-3-enylamino)phenyl]prop-2-enoate (PubChem CID 57024577) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is ethyl 3-[4-(5-phenylhex-3-enylamino)phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-(5-phenylhex-3-enylamino)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 57024577 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | ethyl 3-[4-(5-phenylhex-3-enylamino)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(NCCC=CC(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H27NO2/c1-3-26-23(25)17-14-20-12-15-22(16-13-20)24-18-8-7-9-19(2)21-10-5-4-6-11-21/h4-7,9-17,19,24H,3,8,18H2,1-2H3 |
| InChIKey | FRUCSNIIXCSVHH-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|