About phenyl N-[[(2-chloro-1,3-thiazol-5-yl)methyl-nitroamino]-methylsulfanylmethylidene]carbamate
phenyl N-[[(2-chloro-1,3-thiazol-5-yl)methyl-nitroamino]-methylsulfanylmethylidene]carbamate (PubChem CID 57024757) has the molecular formula C13H11ClN4O4S2
and a molecular weight of 386.84 g/mol. Its IUPAC name is phenyl N-[[(2-chloro-1,3-thiazol-5-yl)methyl-nitroamino]-methylsulfanylmethylidene]carbamate.
Molecular Properties
| Compound Name | phenyl N-[[(2-chloro-1,3-thiazol-5-yl)methyl-nitroamino]-methylsulfanylmethylidene]carbamate |
| PubChem CID | 57024757 |
| Molecular Formula | C13H11ClN4O4S2 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | phenyl N-[[(2-chloro-1,3-thiazol-5-yl)methyl-nitroamino]-methylsulfanylmethylidene]carbamate |
| SMILES | CSC(=NC(=O)Oc1ccccc1)N(Cc1cnc(Cl)s1)[N+](=O)[O-] |
| InChI | InChI=1S/C13H11ClN4O4S2/c1-23-12(16-13(19)22-9-5-3-2-4-6-9)17(18(20)21)8-10-7-15-11(14)24-10/h2-7H,8H2,1H3 |
| InChIKey | IIOOKFADHFIXHC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 97.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze phenyl N-[[(2-chloro-1,3-thiazol-5-yl)methyl-nitroamino]-methylsulfanylmethylidene]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-[[(2-chloro-1,3-thiazol-5-yl)methyl-nitroamino]-methylsulfanylmethylidene]carbamate?
The IUPAC name of phenyl N-[[(2-chloro-1,3-thiazol-5-yl)methyl-nitroamino]-methylsulfanylmethylidene]carbamate (CID 57024757) is phenyl N-[[(2-chloro-1,3-thiazol-5-yl)methyl-nitroamino]-methylsulfanylmethylidene]carbamate.
What is the SMILES notation for phenyl N-[[(2-chloro-1,3-thiazol-5-yl)methyl-nitroamino]-methylsulfanylmethylidene]carbamate?
The canonical SMILES for phenyl N-[[(2-chloro-1,3-thiazol-5-yl)methyl-nitroamino]-methylsulfanylmethylidene]carbamate is CSC(=NC(=O)Oc1ccccc1)N(Cc1cnc(Cl)s1)[N+](=O)[O-].
What is the InChIKey of phenyl N-[[(2-chloro-1,3-thiazol-5-yl)methyl-nitroamino]-methylsulfanylmethylidene]carbamate?
The InChIKey is IIOOKFADHFIXHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClN4O4S2/c1-23-12(16-13(19)22-9-5-3-2-4-6-9)17(18(20)21)8-10-7-15-11(14)24-10/h2-7H,8H2,1H3.
What are the key properties of phenyl N-[[(2-chloro-1,3-thiazol-5-yl)methyl-nitroamino]-methylsulfanylmethylidene]carbamate?
phenyl N-[[(2-chloro-1,3-thiazol-5-yl)methyl-nitroamino]-methylsulfanylmethylidene]carbamate has a molecular weight of 386.84 g/mol, XLogP of 3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-[[(2-chloro-1,3-thiazol-5-yl)methyl-nitroamino]-methylsulfanylmethylidene]carbamate is sourced from PubChem (CID 57024757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).