C47H50N4O5 — CID 57024825
benzyl (5S)-6-[[(2S)-4-amino-1-naphthalen-2-yl-4-oxobutan-2-yl]-butylamino]-5-[(1-benzylindole-3-carbonyl)amino]-6-oxohexanoate (PubChem CID 57024825) has the molecular formula C47H50N4O5 and a molecular weight of 750.94 g/mol. Its IUPAC name is benzyl (5S)-6-[[(2S)-4-amino-1-naphthalen-2-yl-4-oxobutan-2-yl]-butylamino]-5-[(1-benzylindole-3-carbonyl)amino]-6-oxohexanoate.
| Compound Name | benzyl (5S)-6-[[(2S)-4-amino-1-naphthalen-2-yl-4-oxobutan-2-yl]-butylamino]-5-[(1-benzylindole-3-carbonyl)amino]-6-oxohexanoate |
|---|---|
| PubChem CID | 57024825 |
| Molecular Formula | C47H50N4O5 |
| Molecular Weight | 750.94 g/mol |
| Exact Mass | 750.38 |
| IUPAC Name | benzyl (5S)-6-[[(2S)-4-amino-1-naphthalen-2-yl-4-oxobutan-2-yl]-butylamino]-5-[(1-benzylindole-3-carbonyl)amino]-6-oxohexanoate |
| SMILES | CCCCN(C(=O)[C@H](CCCC(=O)OCc1ccccc1)NC(=O)c1cn(Cc2ccccc2)c2ccccc12)[C@H](CC(N)=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C47H50N4O5/c1-2-3-27-51(39(30-44(48)52)29-36-25-26-37-19-10-11-20-38(37)28-36)47(55)42(22-14-24-45(53)56-33-35-17-8-5-9-18-35)49-46(54)41-32-50(31-34-15-6-4-7-16-34)43-23-13-12-21-40(41)43/h4-13,15-21,23,25-26,28,32,39,42H,2-3,14,22,24,27,29-31,33H2,1H3,(H2,48,52)(H,49,54)/t39-,42-/m0/s1 |
| InChIKey | GLOGEEHJVPIGLC-PYLAIEKPSA-N |
| XLogP | 7.97 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.94 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |