C37H63N3O6 — CID 57025130
3-[2-(11-methyldodecan-6-ylcarbamoylamino)cycloheptyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid (PubChem CID 57025130) has the molecular formula C37H63N3O6 and a molecular weight of 645.93 g/mol. Its IUPAC name is 3-[2-(11-methyldodecan-6-ylcarbamoylamino)cycloheptyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[2-(11-methyldodecan-6-ylcarbamoylamino)cycloheptyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 57025130 |
| Molecular Formula | C37H63N3O6 |
| Molecular Weight | 645.93 g/mol |
| Exact Mass | 645.47 |
| IUPAC Name | 3-[2-(11-methyldodecan-6-ylcarbamoylamino)cycloheptyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
| SMILES | CCCCCC(CCCCC(C)C)NC(=O)NC1CCCCCC1C(CC(=O)O)c1[nH]ccc1C(=O)C1OC(C)(C)OCC1(C)C |
| InChI | InChI=1S/C37H63N3O6/c1-8-9-11-17-26(18-15-14-16-25(2)3)39-35(44)40-30-20-13-10-12-19-27(30)29(23-31(41)42)32-28(21-22-38-32)33(43)34-36(4,5)24-45-37(6,7)46-34/h21-22,25-27,29-30,34,38H,8-20,23-24H2,1-7H3,(H,41,42)(H2,39,40,44) |
| InChIKey | YZGXNRTVKQNJPX-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.93 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|