C18H35NO2S — CID 57025550
5,5-bis(2,2-dimethylpentyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 57025550) has the molecular formula C18H35NO2S and a molecular weight of 329.55 g/mol. Its IUPAC name is 5,5-bis(2,2-dimethylpentyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 5,5-bis(2,2-dimethylpentyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 57025550 |
| Molecular Formula | C18H35NO2S |
| Molecular Weight | 329.55 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 5,5-bis(2,2-dimethylpentyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCCC(C)(C)CC1(CC(C)(C)CCC)SCNC1C(=O)O |
| InChI | InChI=1S/C18H35NO2S/c1-7-9-16(3,4)11-18(12-17(5,6)10-8-2)14(15(20)21)19-13-22-18/h14,19H,7-13H2,1-6H3,(H,20,21) |
| InChIKey | FJIVIBGYCUGQLU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |