C22H29NO2 — CID 57025727
(7S,8R,9S,10R,13S,14S)-4-imino-1,7,10,13-tetramethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydro-5H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 57025727) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is (7S,8R,9S,10R,13S,14S)-4-imino-1,7,10,13-tetramethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydro-5H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (7S,8R,9S,10R,13S,14S)-4-imino-1,7,10,13-tetramethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydro-5H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 57025727 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | (7S,8R,9S,10R,13S,14S)-4-imino-1,7,10,13-tetramethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydro-5H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | [H]/N=C1\C(=O)C=C(C)[C@@]2(C)C1C(=C)[C@@H](C)[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C22H29NO2/c1-11-10-16(24)20(23)19-13(3)12(2)18-14-6-7-17(25)21(14,4)9-8-15(18)22(11,19)5/h10,12,14-15,18-19,23H,3,6-9H2,1-2,4-5H3/b23-20+/t12-,14+,15+,18+,19?,21+,22-/m1/s1 |
| InChIKey | RTVOCMSKNPTPGR-CQWYRHMOSA-N |
| XLogP | 4.38 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|