C16H15ClN4O — CID 57025885
5-(3-chlorophenyl)-3-N-(3-methoxyphenyl)-1H-pyrazole-3,4-diamine (PubChem CID 57025885) has the molecular formula C16H15ClN4O and a molecular weight of 314.78 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-3-N-(3-methoxyphenyl)-1H-pyrazole-3,4-diamine.
| Compound Name | 5-(3-chlorophenyl)-3-N-(3-methoxyphenyl)-1H-pyrazole-3,4-diamine |
|---|---|
| PubChem CID | 57025885 |
| Molecular Formula | C16H15ClN4O |
| Molecular Weight | 314.78 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 5-(3-chlorophenyl)-3-N-(3-methoxyphenyl)-1H-pyrazole-3,4-diamine |
| SMILES | COc1cccc(Nc2n[nH]c(-c3cccc(Cl)c3)c2N)c1 |
| InChI | InChI=1S/C16H15ClN4O/c1-22-13-7-3-6-12(9-13)19-16-14(18)15(20-21-16)10-4-2-5-11(17)8-10/h2-9H,18H2,1H3,(H2,19,20,21) |
| InChIKey | XBVXXQPLVXOZTP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.78 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |