About 4-(4-azidophenyl)-4-(2,5-dihydroxypyrrol-1-yl)-4-sulfobutanoic acid
4-(4-azidophenyl)-4-(2,5-dihydroxypyrrol-1-yl)-4-sulfobutanoic acid (PubChem CID 57025990) has the molecular formula C14H14N4O7S
and a molecular weight of 382.35 g/mol. Its IUPAC name is 4-(4-azidophenyl)-4-(2,5-dihydroxypyrrol-1-yl)-4-sulfobutanoic acid.
Molecular Properties
| Compound Name | 4-(4-azidophenyl)-4-(2,5-dihydroxypyrrol-1-yl)-4-sulfobutanoic acid |
| PubChem CID | 57025990 |
| Molecular Formula | C14H14N4O7S |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 4-(4-azidophenyl)-4-(2,5-dihydroxypyrrol-1-yl)-4-sulfobutanoic acid |
| SMILES | [N-]=[N+]=Nc1ccc(C(CCC(=O)O)(n2c(O)ccc2O)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C14H14N4O7S/c15-17-16-10-3-1-9(2-4-10)14(26(23,24)25,8-7-13(21)22)18-11(19)5-6-12(18)20/h1-6,19-20H,7-8H2,(H,21,22)(H,23,24,25) |
| InChIKey | QMANTUSLYHSZGH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 185.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-azidophenyl)-4-(2,5-dihydroxypyrrol-1-yl)-4-sulfobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-azidophenyl)-4-(2,5-dihydroxypyrrol-1-yl)-4-sulfobutanoic acid?
The IUPAC name of 4-(4-azidophenyl)-4-(2,5-dihydroxypyrrol-1-yl)-4-sulfobutanoic acid (CID 57025990) is 4-(4-azidophenyl)-4-(2,5-dihydroxypyrrol-1-yl)-4-sulfobutanoic acid.
What is the SMILES notation for 4-(4-azidophenyl)-4-(2,5-dihydroxypyrrol-1-yl)-4-sulfobutanoic acid?
The canonical SMILES for 4-(4-azidophenyl)-4-(2,5-dihydroxypyrrol-1-yl)-4-sulfobutanoic acid is [N-]=[N+]=Nc1ccc(C(CCC(=O)O)(n2c(O)ccc2O)S(=O)(=O)O)cc1.
What is the InChIKey of 4-(4-azidophenyl)-4-(2,5-dihydroxypyrrol-1-yl)-4-sulfobutanoic acid?
The InChIKey is QMANTUSLYHSZGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O7S/c15-17-16-10-3-1-9(2-4-10)14(26(23,24)25,8-7-13(21)22)18-11(19)5-6-12(18)20/h1-6,19-20H,7-8H2,(H,21,22)(H,23,24,25).
What are the key properties of 4-(4-azidophenyl)-4-(2,5-dihydroxypyrrol-1-yl)-4-sulfobutanoic acid?
4-(4-azidophenyl)-4-(2,5-dihydroxypyrrol-1-yl)-4-sulfobutanoic acid has a molecular weight of 382.35 g/mol, XLogP of 2.29, 7 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-azidophenyl)-4-(2,5-dihydroxypyrrol-1-yl)-4-sulfobutanoic acid is sourced from PubChem (CID 57025990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).