C20H34O3S — CID 57026098
9-[(2S,3R)-3-hydroxy-6-(2-hydroxyethylidene)-2-methyloxepan-2-yl]-2,6-dimethylnon-2-ene-5-thione (PubChem CID 57026098) has the molecular formula C20H34O3S and a molecular weight of 354.56 g/mol. Its IUPAC name is 9-[(2S,3R)-3-hydroxy-6-(2-hydroxyethylidene)-2-methyloxepan-2-yl]-2,6-dimethylnon-2-ene-5-thione.
| Compound Name | 9-[(2S,3R)-3-hydroxy-6-(2-hydroxyethylidene)-2-methyloxepan-2-yl]-2,6-dimethylnon-2-ene-5-thione |
|---|---|
| PubChem CID | 57026098 |
| Molecular Formula | C20H34O3S |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 9-[(2S,3R)-3-hydroxy-6-(2-hydroxyethylidene)-2-methyloxepan-2-yl]-2,6-dimethylnon-2-ene-5-thione |
| SMILES | CC(C)=CCC(=S)C(C)CCC[C@]1(C)OCC(=CCO)CC[C@H]1O |
| InChI | InChI=1S/C20H34O3S/c1-15(2)7-9-18(24)16(3)6-5-12-20(4)19(22)10-8-17(11-13-21)14-23-20/h7,11,16,19,21-22H,5-6,8-10,12-14H2,1-4H3/t16?,19-,20+/m1/s1 |
| InChIKey | NHWPNVXMTUGRAW-OHAXFNJZSA-N |
| XLogP | 4.37 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|