C18H37N3 — CID 57026119
7,7,9,9-tetramethyl-1-piperazin-1-yldec-4-en-2-amine (PubChem CID 57026119) has the molecular formula C18H37N3 and a molecular weight of 295.52 g/mol. Its IUPAC name is 7,7,9,9-tetramethyl-1-piperazin-1-yldec-4-en-2-amine.
| Compound Name | 7,7,9,9-tetramethyl-1-piperazin-1-yldec-4-en-2-amine |
|---|---|
| PubChem CID | 57026119 |
| Molecular Formula | C18H37N3 |
| Molecular Weight | 295.52 g/mol |
| Exact Mass | 295.30 |
| IUPAC Name | 7,7,9,9-tetramethyl-1-piperazin-1-yldec-4-en-2-amine |
| SMILES | CC(C)(C)CC(C)(C)CC=CCC(N)CN1CCNCC1 |
| InChI | InChI=1S/C18H37N3/c1-17(2,3)15-18(4,5)9-7-6-8-16(19)14-21-12-10-20-11-13-21/h6-7,16,20H,8-15,19H2,1-5H3 |
| InChIKey | YPOMHNHKXPOUDV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|