About 2-bromohex-4-enoic acid
2-bromohex-4-enoic acid (PubChem CID 57026294) has the molecular formula C6H9BrO2
and a molecular weight of 193.04 g/mol. Its IUPAC name is 2-bromohex-4-enoic acid.
Molecular Properties
| Compound Name | 2-bromohex-4-enoic acid |
| PubChem CID | 57026294 |
| Molecular Formula | C6H9BrO2 |
| Molecular Weight | 193.04 g/mol |
| Exact Mass | 191.98 |
| IUPAC Name | 2-bromohex-4-enoic acid |
| SMILES | CC=CCC(Br)C(=O)O |
| InChI | InChI=1S/C6H9BrO2/c1-2-3-4-5(7)6(8)9/h2-3,5H,4H2,1H3,(H,8,9) |
| InChIKey | QEGJKFUEZOJMNV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.04 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bromohex-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromohex-4-enoic acid?
The IUPAC name of 2-bromohex-4-enoic acid (CID 57026294) is 2-bromohex-4-enoic acid.
What is the SMILES notation for 2-bromohex-4-enoic acid?
The canonical SMILES for 2-bromohex-4-enoic acid is CC=CCC(Br)C(=O)O.
What is the InChIKey of 2-bromohex-4-enoic acid?
The InChIKey is QEGJKFUEZOJMNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrO2/c1-2-3-4-5(7)6(8)9/h2-3,5H,4H2,1H3,(H,8,9).
What are the key properties of 2-bromohex-4-enoic acid?
2-bromohex-4-enoic acid has a molecular weight of 193.04 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromohex-4-enoic acid is sourced from PubChem (CID 57026294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).