2-bromohex-4-enoic acid

C6H9BrO2 — CID 57026294

IUPAC2-bromohex-4-enoic acid
SMILESCC=CCC(Br)C(=O)O
InChIInChI=1S/C6H9BrO2/c1-2-3-4-5(7)6(8)9/h2-3,5H,4H2,1H3,(H,8,9)
InChIKeyQEGJKFUEZOJMNV-UHFFFAOYSA-N
MW193.04 g/mol
LogP1.80
Rot. Bonds3

About 2-bromohex-4-enoic acid

2-bromohex-4-enoic acid (PubChem CID 57026294) has the molecular formula C6H9BrO2 and a molecular weight of 193.04 g/mol. Its IUPAC name is 2-bromohex-4-enoic acid.

Molecular Properties

Compound Name2-bromohex-4-enoic acid
PubChem CID57026294
Molecular FormulaC6H9BrO2
Molecular Weight193.04 g/mol
Exact Mass191.98
IUPAC Name2-bromohex-4-enoic acid
SMILESCC=CCC(Br)C(=O)O
InChIInChI=1S/C6H9BrO2/c1-2-3-4-5(7)6(8)9/h2-3,5H,4H2,1H3,(H,8,9)
InChIKeyQEGJKFUEZOJMNV-UHFFFAOYSA-N
XLogP1.80
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.04
LogP ≤ 51.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-bromohex-4-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-bromohex-4-enoic acid?
The IUPAC name of 2-bromohex-4-enoic acid (CID 57026294) is 2-bromohex-4-enoic acid.
What is the SMILES notation for 2-bromohex-4-enoic acid?
The canonical SMILES for 2-bromohex-4-enoic acid is CC=CCC(Br)C(=O)O.
What is the InChIKey of 2-bromohex-4-enoic acid?
The InChIKey is QEGJKFUEZOJMNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrO2/c1-2-3-4-5(7)6(8)9/h2-3,5H,4H2,1H3,(H,8,9).
What are the key properties of 2-bromohex-4-enoic acid?
2-bromohex-4-enoic acid has a molecular weight of 193.04 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromohex-4-enoic acid is sourced from PubChem (CID 57026294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).