C28H21FN4O4S — CID 57026516
2-(2,1,3-benzothiadiazol-5-yl)-4-(3-fluoro-4-propoxyphenyl)-4-oxo-3-(quinoxalin-6-ylmethyl)but-2-enoic acid (PubChem CID 57026516) has the molecular formula C28H21FN4O4S and a molecular weight of 528.57 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-5-yl)-4-(3-fluoro-4-propoxyphenyl)-4-oxo-3-(quinoxalin-6-ylmethyl)but-2-enoic acid.
| Compound Name | 2-(2,1,3-benzothiadiazol-5-yl)-4-(3-fluoro-4-propoxyphenyl)-4-oxo-3-(quinoxalin-6-ylmethyl)but-2-enoic acid |
|---|---|
| PubChem CID | 57026516 |
| Molecular Formula | C28H21FN4O4S |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-5-yl)-4-(3-fluoro-4-propoxyphenyl)-4-oxo-3-(quinoxalin-6-ylmethyl)but-2-enoic acid |
| SMILES | CCCOc1ccc(C(=O)C(Cc2ccc3nccnc3c2)=C(C(=O)O)c2ccc3nsnc3c2)cc1F |
| InChI | InChI=1S/C28H21FN4O4S/c1-2-11-37-25-8-5-18(14-20(25)29)27(34)19(12-16-3-6-21-23(13-16)31-10-9-30-21)26(28(35)36)17-4-7-22-24(15-17)33-38-32-22/h3-10,13-15H,2,11-12H2,1H3,(H,35,36) |
| InChIKey | YDTILTHLUAHPMC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 115.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|