About N-(2,4-dimethylphenyl)-N'-[(2,4-dimethylphenyl)iminomethyl]ethanimidamide
N-(2,4-dimethylphenyl)-N'-[(2,4-dimethylphenyl)iminomethyl]ethanimidamide (PubChem CID 57026646) has the molecular formula C19H23N3
and a molecular weight of 293.41 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-N'-[(2,4-dimethylphenyl)iminomethyl]ethanimidamide.
Molecular Properties
| Compound Name | N-(2,4-dimethylphenyl)-N'-[(2,4-dimethylphenyl)iminomethyl]ethanimidamide |
| PubChem CID | 57026646 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | N-(2,4-dimethylphenyl)-N'-[(2,4-dimethylphenyl)iminomethyl]ethanimidamide |
| SMILES | C/C(=N\C=N\c1ccc(C)cc1C)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C19H23N3/c1-13-6-8-18(15(3)10-13)21-12-20-17(5)22-19-9-7-14(2)11-16(19)4/h6-12H,1-5H3,(H,20,21,22) |
| InChIKey | AHGULZUKSJUBOW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(2,4-dimethylphenyl)-N'-[(2,4-dimethylphenyl)iminomethyl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-dimethylphenyl)-N'-[(2,4-dimethylphenyl)iminomethyl]ethanimidamide?
The IUPAC name of N-(2,4-dimethylphenyl)-N'-[(2,4-dimethylphenyl)iminomethyl]ethanimidamide (CID 57026646) is N-(2,4-dimethylphenyl)-N'-[(2,4-dimethylphenyl)iminomethyl]ethanimidamide.
What is the SMILES notation for N-(2,4-dimethylphenyl)-N'-[(2,4-dimethylphenyl)iminomethyl]ethanimidamide?
The canonical SMILES for N-(2,4-dimethylphenyl)-N'-[(2,4-dimethylphenyl)iminomethyl]ethanimidamide is C/C(=N\C=N\c1ccc(C)cc1C)Nc1ccc(C)cc1C.
What is the InChIKey of N-(2,4-dimethylphenyl)-N'-[(2,4-dimethylphenyl)iminomethyl]ethanimidamide?
The InChIKey is AHGULZUKSJUBOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3/c1-13-6-8-18(15(3)10-13)21-12-20-17(5)22-19-9-7-14(2)11-16(19)4/h6-12H,1-5H3,(H,20,21,22).
What are the key properties of N-(2,4-dimethylphenyl)-N'-[(2,4-dimethylphenyl)iminomethyl]ethanimidamide?
N-(2,4-dimethylphenyl)-N'-[(2,4-dimethylphenyl)iminomethyl]ethanimidamide has a molecular weight of 293.41 g/mol, XLogP of 5.11, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-dimethylphenyl)-N'-[(2,4-dimethylphenyl)iminomethyl]ethanimidamide is sourced from PubChem (CID 57026646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).