C18H12F14O — CID 57026860
6,7,8,8,9,9,9-heptafluoro-4-(6,7,8,8,9,9,9-heptafluoronona-1,4,6-trien-4-yloxy)nona-1,4,6-triene (PubChem CID 57026860) has the molecular formula C18H12F14O and a molecular weight of 510.27 g/mol. Its IUPAC name is 6,7,8,8,9,9,9-heptafluoro-4-(6,7,8,8,9,9,9-heptafluoronona-1,4,6-trien-4-yloxy)nona-1,4,6-triene.
| Compound Name | 6,7,8,8,9,9,9-heptafluoro-4-(6,7,8,8,9,9,9-heptafluoronona-1,4,6-trien-4-yloxy)nona-1,4,6-triene |
|---|---|
| PubChem CID | 57026860 |
| Molecular Formula | C18H12F14O |
| Molecular Weight | 510.27 g/mol |
| Exact Mass | 510.07 |
| IUPAC Name | 6,7,8,8,9,9,9-heptafluoro-4-(6,7,8,8,9,9,9-heptafluoronona-1,4,6-trien-4-yloxy)nona-1,4,6-triene |
| SMILES | C=CCC(=CC(F)=C(F)C(F)(F)C(F)(F)F)OC(=CC(F)=C(F)C(F)(F)C(F)(F)F)CC=C |
| InChI | InChI=1S/C18H12F14O/c1-3-5-9(7-11(19)13(21)15(23,24)17(27,28)29)33-10(6-4-2)8-12(20)14(22)16(25,26)18(30,31)32/h3-4,7-8H,1-2,5-6H2 |
| InChIKey | YRKDKORWSRWSPB-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.27 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|