C10H16F6N+ — CID 57026965
triethyl-(2,2,3,3,4,4-hexafluorocyclobutyl)azanium (PubChem CID 57026965) has the molecular formula C10H16F6N+ and a molecular weight of 264.23 g/mol. Its IUPAC name is triethyl-(2,2,3,3,4,4-hexafluorocyclobutyl)azanium.
| Compound Name | triethyl-(2,2,3,3,4,4-hexafluorocyclobutyl)azanium |
|---|---|
| PubChem CID | 57026965 |
| Molecular Formula | C10H16F6N+ |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | triethyl-(2,2,3,3,4,4-hexafluorocyclobutyl)azanium |
| SMILES | CC[N+](CC)(CC)C1C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H16F6N/c1-4-17(5-2,6-3)7-8(11,12)10(15,16)9(7,13)14/h7H,4-6H2,1-3H3/q+1 |
| InChIKey | NLNDZOGZORMJSS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|