C33H45N5O4 — CID 57027046
(2S)-N-[(2R)-1-(3-imidazol-1-ylpropylamino)-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]-4-methyl-2-(oxan-4-ylamino)pentanamide (PubChem CID 57027046) has the molecular formula C33H45N5O4 and a molecular weight of 575.75 g/mol. Its IUPAC name is (2S)-N-[(2R)-1-(3-imidazol-1-ylpropylamino)-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]-4-methyl-2-(oxan-4-ylamino)pentanamide.
| Compound Name | (2S)-N-[(2R)-1-(3-imidazol-1-ylpropylamino)-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]-4-methyl-2-(oxan-4-ylamino)pentanamide |
|---|---|
| PubChem CID | 57027046 |
| Molecular Formula | C33H45N5O4 |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 575.35 |
| IUPAC Name | (2S)-N-[(2R)-1-(3-imidazol-1-ylpropylamino)-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]-4-methyl-2-(oxan-4-ylamino)pentanamide |
| SMILES | CC(C)C[C@H](NC1CCOCC1)C(=O)N[C@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C33H45N5O4/c1-25(2)21-30(36-28-13-19-41-20-14-28)33(40)37-31(32(39)35-15-6-17-38-18-16-34-24-38)22-26-9-11-29(12-10-26)42-23-27-7-4-3-5-8-27/h3-5,7-12,16,18,24-25,28,30-31,36H,6,13-15,17,19-23H2,1-2H3,(H,35,39)(H,37,40)/t30-,31+/m0/s1 |
| InChIKey | VWKVTDNUOQTLCA-IOWSJCHKSA-N |
| XLogP | 3.88 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|