C22H30O4 — CID 57027223
(8S,9S,10R,11S,13S,14S,17R)-17-acetyl-11,17-dihydroxy-2,10,13-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 57027223) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is (8S,9S,10R,11S,13S,14S,17R)-17-acetyl-11,17-dihydroxy-2,10,13-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,11S,13S,14S,17R)-17-acetyl-11,17-dihydroxy-2,10,13-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57027223 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (8S,9S,10R,11S,13S,14S,17R)-17-acetyl-11,17-dihydroxy-2,10,13-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)C(C)=C[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C22H30O4/c1-12-10-20(3)14(9-17(12)24)5-6-15-16-7-8-22(26,13(2)23)21(16,4)11-18(25)19(15)20/h9-10,15-16,18-19,25-26H,5-8,11H2,1-4H3/t15-,16-,18-,19+,20-,21-,22-/m0/s1 |
| InChIKey | NEMLDEQEGPTMSF-SOWWUCBVSA-N |
| XLogP | 2.98 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |