About 2-cyclobutylbenzene-1,4-diamine
2-cyclobutylbenzene-1,4-diamine (PubChem CID 57027381) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-cyclobutylbenzene-1,4-diamine.
Molecular Properties
| Compound Name | 2-cyclobutylbenzene-1,4-diamine |
| PubChem CID | 57027381 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-cyclobutylbenzene-1,4-diamine |
| SMILES | Nc1ccc(N)c(C2CCC2)c1 |
| InChI | InChI=1S/C10H14N2/c11-8-4-5-10(12)9(6-8)7-2-1-3-7/h4-7H,1-3,11-12H2 |
| InChIKey | DVEGRLCNPJQMEV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclobutylbenzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutylbenzene-1,4-diamine?
The IUPAC name of 2-cyclobutylbenzene-1,4-diamine (CID 57027381) is 2-cyclobutylbenzene-1,4-diamine.
What is the SMILES notation for 2-cyclobutylbenzene-1,4-diamine?
The canonical SMILES for 2-cyclobutylbenzene-1,4-diamine is Nc1ccc(N)c(C2CCC2)c1.
What is the InChIKey of 2-cyclobutylbenzene-1,4-diamine?
The InChIKey is DVEGRLCNPJQMEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c11-8-4-5-10(12)9(6-8)7-2-1-3-7/h4-7H,1-3,11-12H2.
What are the key properties of 2-cyclobutylbenzene-1,4-diamine?
2-cyclobutylbenzene-1,4-diamine has a molecular weight of 162.24 g/mol, XLogP of 2.12, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutylbenzene-1,4-diamine is sourced from PubChem (CID 57027381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).