About 3-[(1-methoxy-2,3-dihydroinden-1-yl)oxy]propan-1-amine
3-[(1-methoxy-2,3-dihydroinden-1-yl)oxy]propan-1-amine (PubChem CID 57028367) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-[(1-methoxy-2,3-dihydroinden-1-yl)oxy]propan-1-amine.
Molecular Properties
| Compound Name | 3-[(1-methoxy-2,3-dihydroinden-1-yl)oxy]propan-1-amine |
| PubChem CID | 57028367 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 3-[(1-methoxy-2,3-dihydroinden-1-yl)oxy]propan-1-amine |
| SMILES | COC1(OCCCN)CCc2ccccc21 |
| InChI | InChI=1S/C13H19NO2/c1-15-13(16-10-4-9-14)8-7-11-5-2-3-6-12(11)13/h2-3,5-6H,4,7-10,14H2,1H3 |
| InChIKey | MMMUJGHEHKIEPE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1-methoxy-2,3-dihydroinden-1-yl)oxy]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-methoxy-2,3-dihydroinden-1-yl)oxy]propan-1-amine?
The IUPAC name of 3-[(1-methoxy-2,3-dihydroinden-1-yl)oxy]propan-1-amine (CID 57028367) is 3-[(1-methoxy-2,3-dihydroinden-1-yl)oxy]propan-1-amine.
What is the SMILES notation for 3-[(1-methoxy-2,3-dihydroinden-1-yl)oxy]propan-1-amine?
The canonical SMILES for 3-[(1-methoxy-2,3-dihydroinden-1-yl)oxy]propan-1-amine is COC1(OCCCN)CCc2ccccc21.
What is the InChIKey of 3-[(1-methoxy-2,3-dihydroinden-1-yl)oxy]propan-1-amine?
The InChIKey is MMMUJGHEHKIEPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-15-13(16-10-4-9-14)8-7-11-5-2-3-6-12(11)13/h2-3,5-6H,4,7-10,14H2,1H3.
What are the key properties of 3-[(1-methoxy-2,3-dihydroinden-1-yl)oxy]propan-1-amine?
3-[(1-methoxy-2,3-dihydroinden-1-yl)oxy]propan-1-amine has a molecular weight of 221.30 g/mol, XLogP of 1.80, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-methoxy-2,3-dihydroinden-1-yl)oxy]propan-1-amine is sourced from PubChem (CID 57028367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).