About methyl 2-imino-6,6-dimethylheptanoate
methyl 2-imino-6,6-dimethylheptanoate (PubChem CID 57029020) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is methyl 2-imino-6,6-dimethylheptanoate.
Molecular Properties
| Compound Name | methyl 2-imino-6,6-dimethylheptanoate |
| PubChem CID | 57029020 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | methyl 2-imino-6,6-dimethylheptanoate |
| SMILES | [H]/N=C(/CCCC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C10H19NO2/c1-10(2,3)7-5-6-8(11)9(12)13-4/h11H,5-7H2,1-4H3/b11-8- |
| InChIKey | XWESKHATBLHGQH-FLIBITNWSA-N |
| XLogP | 2.40 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-imino-6,6-dimethylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-imino-6,6-dimethylheptanoate?
The IUPAC name of methyl 2-imino-6,6-dimethylheptanoate (CID 57029020) is methyl 2-imino-6,6-dimethylheptanoate.
What is the SMILES notation for methyl 2-imino-6,6-dimethylheptanoate?
The canonical SMILES for methyl 2-imino-6,6-dimethylheptanoate is [H]/N=C(/CCCC(C)(C)C)C(=O)OC.
What is the InChIKey of methyl 2-imino-6,6-dimethylheptanoate?
The InChIKey is XWESKHATBLHGQH-FLIBITNWSA-N. The full InChI is InChI=1S/C10H19NO2/c1-10(2,3)7-5-6-8(11)9(12)13-4/h11H,5-7H2,1-4H3/b11-8-.
What are the key properties of methyl 2-imino-6,6-dimethylheptanoate?
methyl 2-imino-6,6-dimethylheptanoate has a molecular weight of 185.27 g/mol, XLogP of 2.40, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-imino-6,6-dimethylheptanoate is sourced from PubChem (CID 57029020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).