C24H39NO3Si — CID 57029384
(3R,4S)-1-(3,3-dimethylbutanoyl)-4-phenyl-3-tri(propan-2-yl)silyloxyazetidin-2-one (PubChem CID 57029384) has the molecular formula C24H39NO3Si and a molecular weight of 417.67 g/mol. Its IUPAC name is (3R,4S)-1-(3,3-dimethylbutanoyl)-4-phenyl-3-tri(propan-2-yl)silyloxyazetidin-2-one.
| Compound Name | (3R,4S)-1-(3,3-dimethylbutanoyl)-4-phenyl-3-tri(propan-2-yl)silyloxyazetidin-2-one |
|---|---|
| PubChem CID | 57029384 |
| Molecular Formula | C24H39NO3Si |
| Molecular Weight | 417.67 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | (3R,4S)-1-(3,3-dimethylbutanoyl)-4-phenyl-3-tri(propan-2-yl)silyloxyazetidin-2-one |
| SMILES | CC(C)[Si](O[C@H]1C(=O)N(C(=O)CC(C)(C)C)[C@H]1c1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H39NO3Si/c1-16(2)29(17(3)4,18(5)6)28-22-21(19-13-11-10-12-14-19)25(23(22)27)20(26)15-24(7,8)9/h10-14,16-18,21-22H,15H2,1-9H3/t21-,22+/m0/s1 |
| InChIKey | JUMGUJWSSCELCQ-FCHUYYIVSA-N |
| XLogP | 6.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.67 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|