About 2-[1-hydroxy-3,3-bis(4-phenoxyphenyl)propyl]-4-methylbenzenesulfonic acid
2-[1-hydroxy-3,3-bis(4-phenoxyphenyl)propyl]-4-methylbenzenesulfonic acid (PubChem CID 57029763) has the molecular formula C34H30O6S
and a molecular weight of 566.68 g/mol. Its IUPAC name is 2-[1-hydroxy-3,3-bis(4-phenoxyphenyl)propyl]-4-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | 2-[1-hydroxy-3,3-bis(4-phenoxyphenyl)propyl]-4-methylbenzenesulfonic acid |
| PubChem CID | 57029763 |
| Molecular Formula | C34H30O6S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | 2-[1-hydroxy-3,3-bis(4-phenoxyphenyl)propyl]-4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(C(O)CC(c2ccc(Oc3ccccc3)cc2)c2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C34H30O6S/c1-24-12-21-34(41(36,37)38)32(22-24)33(35)23-31(25-13-17-29(18-14-25)39-27-8-4-2-5-9-27)26-15-19-30(20-16-26)40-28-10-6-3-7-11-28/h2-22,31,33,35H,23H2,1H3,(H,36,37,38) |
| InChIKey | ZNLYTHJIKLFBCM-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-hydroxy-3,3-bis(4-phenoxyphenyl)propyl]-4-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-hydroxy-3,3-bis(4-phenoxyphenyl)propyl]-4-methylbenzenesulfonic acid?
The IUPAC name of 2-[1-hydroxy-3,3-bis(4-phenoxyphenyl)propyl]-4-methylbenzenesulfonic acid (CID 57029763) is 2-[1-hydroxy-3,3-bis(4-phenoxyphenyl)propyl]-4-methylbenzenesulfonic acid.
What is the SMILES notation for 2-[1-hydroxy-3,3-bis(4-phenoxyphenyl)propyl]-4-methylbenzenesulfonic acid?
The canonical SMILES for 2-[1-hydroxy-3,3-bis(4-phenoxyphenyl)propyl]-4-methylbenzenesulfonic acid is Cc1ccc(S(=O)(=O)O)c(C(O)CC(c2ccc(Oc3ccccc3)cc2)c2ccc(Oc3ccccc3)cc2)c1.
What is the InChIKey of 2-[1-hydroxy-3,3-bis(4-phenoxyphenyl)propyl]-4-methylbenzenesulfonic acid?
The InChIKey is ZNLYTHJIKLFBCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H30O6S/c1-24-12-21-34(41(36,37)38)32(22-24)33(35)23-31(25-13-17-29(18-14-25)39-27-8-4-2-5-9-27)26-15-19-30(20-16-26)40-28-10-6-3-7-11-28/h2-22,31,33,35H,23H2,1H3,(H,36,37,38).
What are the key properties of 2-[1-hydroxy-3,3-bis(4-phenoxyphenyl)propyl]-4-methylbenzenesulfonic acid?
2-[1-hydroxy-3,3-bis(4-phenoxyphenyl)propyl]-4-methylbenzenesulfonic acid has a molecular weight of 566.68 g/mol, XLogP of 8.08, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-hydroxy-3,3-bis(4-phenoxyphenyl)propyl]-4-methylbenzenesulfonic acid is sourced from PubChem (CID 57029763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).