C30H27BN6 — CID 57030268
tris(5-methyl-3-phenyl-1H-pyrazol-4-yl)borane (PubChem CID 57030268) has the molecular formula C30H27BN6 and a molecular weight of 482.40 g/mol. Its IUPAC name is tris(5-methyl-3-phenyl-1H-pyrazol-4-yl)borane.
| Compound Name | tris(5-methyl-3-phenyl-1H-pyrazol-4-yl)borane |
|---|---|
| PubChem CID | 57030268 |
| Molecular Formula | C30H27BN6 |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | tris(5-methyl-3-phenyl-1H-pyrazol-4-yl)borane |
| SMILES | Cc1[nH]nc(-c2ccccc2)c1B(c1c(-c2ccccc2)n[nH]c1C)c1c(-c2ccccc2)n[nH]c1C |
| InChI | InChI=1S/C30H27BN6/c1-19-25(28(35-32-19)22-13-7-4-8-14-22)31(26-20(2)33-36-29(26)23-15-9-5-10-16-23)27-21(3)34-37-30(27)24-17-11-6-12-18-24/h4-18H,1-3H3,(H,32,35)(H,33,36)(H,34,37) |
| InChIKey | DQVYDZBXTACFCA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 86.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|