About 4-chloro-1H-furo[3,4-c]quinolin-3-one
4-chloro-1H-furo[3,4-c]quinolin-3-one (PubChem CID 57030353) has the molecular formula C11H6ClNO2
and a molecular weight of 219.63 g/mol. Its IUPAC name is 4-chloro-1H-furo[3,4-c]quinolin-3-one.
Molecular Properties
| Compound Name | 4-chloro-1H-furo[3,4-c]quinolin-3-one |
| PubChem CID | 57030353 |
| Molecular Formula | C11H6ClNO2 |
| Molecular Weight | 219.63 g/mol |
| Exact Mass | 219.01 |
| IUPAC Name | 4-chloro-1H-furo[3,4-c]quinolin-3-one |
| SMILES | O=C1OCc2c1c(Cl)nc1ccccc21 |
| InChI | InChI=1S/C11H6ClNO2/c12-10-9-7(5-15-11(9)14)6-3-1-2-4-8(6)13-10/h1-4H,5H2 |
| InChIKey | DSEYIIFJOISITJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.63 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1H-furo[3,4-c]quinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1H-furo[3,4-c]quinolin-3-one?
The IUPAC name of 4-chloro-1H-furo[3,4-c]quinolin-3-one (CID 57030353) is 4-chloro-1H-furo[3,4-c]quinolin-3-one.
What is the SMILES notation for 4-chloro-1H-furo[3,4-c]quinolin-3-one?
The canonical SMILES for 4-chloro-1H-furo[3,4-c]quinolin-3-one is O=C1OCc2c1c(Cl)nc1ccccc21.
What is the InChIKey of 4-chloro-1H-furo[3,4-c]quinolin-3-one?
The InChIKey is DSEYIIFJOISITJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6ClNO2/c12-10-9-7(5-15-11(9)14)6-3-1-2-4-8(6)13-10/h1-4H,5H2.
What are the key properties of 4-chloro-1H-furo[3,4-c]quinolin-3-one?
4-chloro-1H-furo[3,4-c]quinolin-3-one has a molecular weight of 219.63 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1H-furo[3,4-c]quinolin-3-one is sourced from PubChem (CID 57030353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).