About 2-(2-amino-6-oxo-3,7-dihydro-1H-purin-2-yl)acetamide
2-(2-amino-6-oxo-3,7-dihydro-1H-purin-2-yl)acetamide (PubChem CID 57030380) has the molecular formula C7H10N6O2
and a molecular weight of 210.20 g/mol. Its IUPAC name is 2-(2-amino-6-oxo-3,7-dihydro-1H-purin-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(2-amino-6-oxo-3,7-dihydro-1H-purin-2-yl)acetamide |
| PubChem CID | 57030380 |
| Molecular Formula | C7H10N6O2 |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-(2-amino-6-oxo-3,7-dihydro-1H-purin-2-yl)acetamide |
| SMILES | NC(=O)CC1(N)NC(=O)c2[nH]cnc2N1 |
| InChI | InChI=1S/C7H10N6O2/c8-3(14)1-7(9)12-5-4(6(15)13-7)10-2-11-5/h2,12H,1,9H2,(H2,8,14)(H,10,11)(H,13,15) |
| InChIKey | QGTSKJFFQBGJQV-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 138.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-amino-6-oxo-3,7-dihydro-1H-purin-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-6-oxo-3,7-dihydro-1H-purin-2-yl)acetamide?
The IUPAC name of 2-(2-amino-6-oxo-3,7-dihydro-1H-purin-2-yl)acetamide (CID 57030380) is 2-(2-amino-6-oxo-3,7-dihydro-1H-purin-2-yl)acetamide.
What is the SMILES notation for 2-(2-amino-6-oxo-3,7-dihydro-1H-purin-2-yl)acetamide?
The canonical SMILES for 2-(2-amino-6-oxo-3,7-dihydro-1H-purin-2-yl)acetamide is NC(=O)CC1(N)NC(=O)c2[nH]cnc2N1.
What is the InChIKey of 2-(2-amino-6-oxo-3,7-dihydro-1H-purin-2-yl)acetamide?
The InChIKey is QGTSKJFFQBGJQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N6O2/c8-3(14)1-7(9)12-5-4(6(15)13-7)10-2-11-5/h2,12H,1,9H2,(H2,8,14)(H,10,11)(H,13,15).
What are the key properties of 2-(2-amino-6-oxo-3,7-dihydro-1H-purin-2-yl)acetamide?
2-(2-amino-6-oxo-3,7-dihydro-1H-purin-2-yl)acetamide has a molecular weight of 210.20 g/mol, XLogP of -1.95, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-6-oxo-3,7-dihydro-1H-purin-2-yl)acetamide is sourced from PubChem (CID 57030380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).