About 3H-imidazo[1,2-b][2]benzazepine
3H-imidazo[1,2-b][2]benzazepine (PubChem CID 57030394) has the molecular formula C12H10N2
and a molecular weight of 182.23 g/mol. Its IUPAC name is 3H-imidazo[1,2-b][2]benzazepine.
Molecular Properties
| Compound Name | 3H-imidazo[1,2-b][2]benzazepine |
| PubChem CID | 57030394 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 3H-imidazo[1,2-b][2]benzazepine |
| SMILES | C1=CN2C=c3ccccc3=CC=C2N1 |
| InChI | InChI=1S/C12H10N2/c1-2-4-11-9-14-8-7-13-12(14)6-5-10(11)3-1/h1-9,13H |
| InChIKey | KDIZCMKKXVUTMK-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3H-imidazo[1,2-b][2]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-imidazo[1,2-b][2]benzazepine?
The IUPAC name of 3H-imidazo[1,2-b][2]benzazepine (CID 57030394) is 3H-imidazo[1,2-b][2]benzazepine.
What is the SMILES notation for 3H-imidazo[1,2-b][2]benzazepine?
The canonical SMILES for 3H-imidazo[1,2-b][2]benzazepine is C1=CN2C=c3ccccc3=CC=C2N1.
What is the InChIKey of 3H-imidazo[1,2-b][2]benzazepine?
The InChIKey is KDIZCMKKXVUTMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2/c1-2-4-11-9-14-8-7-13-12(14)6-5-10(11)3-1/h1-9,13H.
What are the key properties of 3H-imidazo[1,2-b][2]benzazepine?
3H-imidazo[1,2-b][2]benzazepine has a molecular weight of 182.23 g/mol, XLogP of 0.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-imidazo[1,2-b][2]benzazepine is sourced from PubChem (CID 57030394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).