C20H21N3 — CID 57030538
1'-methylspiro[1,4-dihydroindolo[3,2-c]quinoline-6,4'-piperidine] (PubChem CID 57030538) has the molecular formula C20H21N3 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1'-methylspiro[1,4-dihydroindolo[3,2-c]quinoline-6,4'-piperidine].
| Compound Name | 1'-methylspiro[1,4-dihydroindolo[3,2-c]quinoline-6,4'-piperidine] |
|---|---|
| PubChem CID | 57030538 |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 1'-methylspiro[1,4-dihydroindolo[3,2-c]quinoline-6,4'-piperidine] |
| SMILES | CN1CCC2(CC1)N=C1CC=CCC1=C1N=c3ccccc3=C12 |
| InChI | InChI=1S/C20H21N3/c1-23-12-10-20(11-13-23)18-14-6-2-4-8-16(14)21-19(18)15-7-3-5-9-17(15)22-20/h2-6,8H,7,9-13H2,1H3 |
| InChIKey | YEVSSVSFLWQUFR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|