C22H16F9O3S2+ — CID 57030767
1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl-(triphenyl-λ4-sulfanyl)oxidanium (PubChem CID 57030767) has the molecular formula C22H16F9O3S2+ and a molecular weight of 563.48 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl-(triphenyl-λ4-sulfanyl)oxidanium.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl-(triphenyl-λ4-sulfanyl)oxidanium |
|---|---|
| PubChem CID | 57030767 |
| Molecular Formula | C22H16F9O3S2+ |
| Molecular Weight | 563.48 g/mol |
| Exact Mass | 563.04 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl-(triphenyl-λ4-sulfanyl)oxidanium |
| SMILES | O=S(=O)([OH+]S(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H15F9O3S2/c23-19(24,21(27,28)29)20(25,26)22(30,31)36(32,33)34-35(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H/p+1 |
| InChIKey | LLDBLEVQDBYOOW-UHFFFAOYSA-O |
| XLogP | 7.73 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.48 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|