About bis[1-(dimethylamino)-4-naphthalen-1-yl-1-phenylbutyl] 2,3-dihydroxybutanedioate
bis[1-(dimethylamino)-4-naphthalen-1-yl-1-phenylbutyl] 2,3-dihydroxybutanedioate (PubChem CID 57030863) has the molecular formula C48H52N2O6
and a molecular weight of 752.95 g/mol. Its IUPAC name is bis[1-(dimethylamino)-4-naphthalen-1-yl-1-phenylbutyl] 2,3-dihydroxybutanedioate.
Molecular Properties
| Compound Name | bis[1-(dimethylamino)-4-naphthalen-1-yl-1-phenylbutyl] 2,3-dihydroxybutanedioate |
| PubChem CID | 57030863 |
| Molecular Formula | C48H52N2O6 |
| Molecular Weight | 752.95 g/mol |
| Exact Mass | 752.38 |
| IUPAC Name | bis[1-(dimethylamino)-4-naphthalen-1-yl-1-phenylbutyl] 2,3-dihydroxybutanedioate |
| SMILES | CN(C)C(CCCc1cccc2ccccc12)(OC(=O)C(O)C(O)C(=O)OC(CCCc1cccc2ccccc12)(c1ccccc1)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C48H52N2O6/c1-49(2)47(39-27-7-5-8-28-39,33-17-25-37-23-15-21-35-19-11-13-31-41(35)37)55-45(53)43(51)44(52)46(54)56-48(50(3)4,40-29-9-6-10-30-40)34-18-26-38-24-16-22-36-20-12-14-32-42(36)38/h5-16,19-24,27-32,43-44,51-52H,17-18,25-26,33-34H2,1-4H3 |
| InChIKey | NXFXOSUFXAVKSU-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 752.95 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze bis[1-(dimethylamino)-4-naphthalen-1-yl-1-phenylbutyl] 2,3-dihydroxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[1-(dimethylamino)-4-naphthalen-1-yl-1-phenylbutyl] 2,3-dihydroxybutanedioate?
The IUPAC name of bis[1-(dimethylamino)-4-naphthalen-1-yl-1-phenylbutyl] 2,3-dihydroxybutanedioate (CID 57030863) is bis[1-(dimethylamino)-4-naphthalen-1-yl-1-phenylbutyl] 2,3-dihydroxybutanedioate.
What is the SMILES notation for bis[1-(dimethylamino)-4-naphthalen-1-yl-1-phenylbutyl] 2,3-dihydroxybutanedioate?
The canonical SMILES for bis[1-(dimethylamino)-4-naphthalen-1-yl-1-phenylbutyl] 2,3-dihydroxybutanedioate is CN(C)C(CCCc1cccc2ccccc12)(OC(=O)C(O)C(O)C(=O)OC(CCCc1cccc2ccccc12)(c1ccccc1)N(C)C)c1ccccc1.
What is the InChIKey of bis[1-(dimethylamino)-4-naphthalen-1-yl-1-phenylbutyl] 2,3-dihydroxybutanedioate?
The InChIKey is NXFXOSUFXAVKSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C48H52N2O6/c1-49(2)47(39-27-7-5-8-28-39,33-17-25-37-23-15-21-35-19-11-13-31-41(35)37)55-45(53)43(51)44(52)46(54)56-48(50(3)4,40-29-9-6-10-30-40)34-18-26-38-24-16-22-36-20-12-14-32-42(36)38/h5-16,19-24,27-32,43-44,51-52H,17-18,25-26,33-34H2,1-4H3.
What are the key properties of bis[1-(dimethylamino)-4-naphthalen-1-yl-1-phenylbutyl] 2,3-dihydroxybutanedioate?
bis[1-(dimethylamino)-4-naphthalen-1-yl-1-phenylbutyl] 2,3-dihydroxybutanedioate has a molecular weight of 752.95 g/mol, XLogP of 7.98, 17 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis[1-(dimethylamino)-4-naphthalen-1-yl-1-phenylbutyl] 2,3-dihydroxybutanedioate is sourced from PubChem (CID 57030863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).