C13H18FNO2 — CID 57030916
(1S,2R,3S)-3-amino-1-cyclopropyl-4-(4-fluorophenyl)butane-1,2-diol (PubChem CID 57030916) has the molecular formula C13H18FNO2 and a molecular weight of 239.29 g/mol. Its IUPAC name is (1S,2R,3S)-3-amino-1-cyclopropyl-4-(4-fluorophenyl)butane-1,2-diol.
| Compound Name | (1S,2R,3S)-3-amino-1-cyclopropyl-4-(4-fluorophenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 57030916 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (1S,2R,3S)-3-amino-1-cyclopropyl-4-(4-fluorophenyl)butane-1,2-diol |
| SMILES | N[C@@H](Cc1ccc(F)cc1)[C@@H](O)[C@@H](O)C1CC1 |
| InChI | InChI=1S/C13H18FNO2/c14-10-5-1-8(2-6-10)7-11(15)13(17)12(16)9-3-4-9/h1-2,5-6,9,11-13,16-17H,3-4,7,15H2/t11-,12-,13+/m0/s1 |
| InChIKey | CMCKOGDYSIDBHI-RWMBFGLXSA-N |
| XLogP | 0.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |