C27H44O4S — CID 57031002
trans-(1R,3S)-5-[2-[(1R,2R,3aS,7aS)-2-hydroxy-1-[(1S)-1-(4-hydroxy-4-methylpentyl)sulfanylethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol (PubChem CID 57031002) has the molecular formula C27H44O4S and a molecular weight of 464.71 g/mol. Its IUPAC name is trans-(1R,3S)-5-[2-[(1R,2R,3aS,7aS)-2-hydroxy-1-[(1S)-1-(4-hydroxy-4-methylpentyl)sulfanylethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3S)-5-[2-[(1R,2R,3aS,7aS)-2-hydroxy-1-[(1S)-1-(4-hydroxy-4-methylpentyl)sulfanylethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 57031002 |
| Molecular Formula | C27H44O4S |
| Molecular Weight | 464.71 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | trans-(1R,3S)-5-[2-[(1R,2R,3aS,7aS)-2-hydroxy-1-[(1S)-1-(4-hydroxy-4-methylpentyl)sulfanylethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)[C@@H]([C@H](C)SCCCC(C)(C)O)[C@H](O)C[C@@H]23)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C27H44O4S/c1-17-20(14-21(28)15-23(17)29)10-9-19-8-6-12-27(5)22(19)16-24(30)25(27)18(2)32-13-7-11-26(3,4)31/h9-10,18,21-25,28-31H,1,6-8,11-16H2,2-5H3/t18-,21+,22-,23-,24+,25-,27-/m0/s1 |
| InChIKey | ATOVGWOISLVQTM-RKPFVVLKSA-N |
| XLogP | 4.77 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.71 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|