C25H28N2O3 — CID 57031748
1,5-bis(4-morpholin-4-ylphenyl)penta-1,4-dien-3-one (PubChem CID 57031748) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 1,5-bis(4-morpholin-4-ylphenyl)penta-1,4-dien-3-one.
| Compound Name | 1,5-bis(4-morpholin-4-ylphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 57031748 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 1,5-bis(4-morpholin-4-ylphenyl)penta-1,4-dien-3-one |
| SMILES | O=C(C=Cc1ccc(N2CCOCC2)cc1)C=Cc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H28N2O3/c28-25(11-5-21-1-7-23(8-2-21)26-13-17-29-18-14-26)12-6-22-3-9-24(10-4-22)27-15-19-30-20-16-27/h1-12H,13-20H2 |
| InChIKey | ZAFNYDLXFMWKLQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|