About (6-cyano-2-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate
(6-cyano-2-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate (PubChem CID 57031985) has the molecular formula C16H17N3O3
and a molecular weight of 299.33 g/mol. Its IUPAC name is (6-cyano-2-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate.
Molecular Properties
| Compound Name | (6-cyano-2-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate |
| PubChem CID | 57031985 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (6-cyano-2-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate |
| SMILES | CC(C)(Cn1cccc1)C(O)C(=O)Oc1cccc(C#N)n1 |
| InChI | InChI=1S/C16H17N3O3/c1-16(2,11-19-8-3-4-9-19)14(20)15(21)22-13-7-5-6-12(10-17)18-13/h3-9,14,20H,11H2,1-2H3 |
| InChIKey | STORYXXHKAIALT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (6-cyano-2-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-cyano-2-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate?
The IUPAC name of (6-cyano-2-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate (CID 57031985) is (6-cyano-2-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate.
What is the SMILES notation for (6-cyano-2-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate?
The canonical SMILES for (6-cyano-2-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate is CC(C)(Cn1cccc1)C(O)C(=O)Oc1cccc(C#N)n1.
What is the InChIKey of (6-cyano-2-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate?
The InChIKey is STORYXXHKAIALT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O3/c1-16(2,11-19-8-3-4-9-19)14(20)15(21)22-13-7-5-6-12(10-17)18-13/h3-9,14,20H,11H2,1-2H3.
What are the key properties of (6-cyano-2-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate?
(6-cyano-2-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate has a molecular weight of 299.33 g/mol, XLogP of 1.75, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-cyano-2-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate is sourced from PubChem (CID 57031985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).