C21H32F6O2Si — CID 57032789
(1R,3aR,7aR)-7a-methyl-1-[7,7,7-trifluoro-6-(trifluoromethyl)-6-trimethylsilyloxyhept-4-en-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 57032789) has the molecular formula C21H32F6O2Si and a molecular weight of 458.56 g/mol. Its IUPAC name is (1R,3aR,7aR)-7a-methyl-1-[7,7,7-trifluoro-6-(trifluoromethyl)-6-trimethylsilyloxyhept-4-en-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,3aR,7aR)-7a-methyl-1-[7,7,7-trifluoro-6-(trifluoromethyl)-6-trimethylsilyloxyhept-4-en-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 57032789 |
| Molecular Formula | C21H32F6O2Si |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | (1R,3aR,7aR)-7a-methyl-1-[7,7,7-trifluoro-6-(trifluoromethyl)-6-trimethylsilyloxyhept-4-en-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | CC(CC=CC(O[Si](C)(C)C)(C(F)(F)F)C(F)(F)F)[C@H]1CC[C@H]2C(=O)CCC[C@]12C |
| InChI | InChI=1S/C21H32F6O2Si/c1-14(15-10-11-16-17(28)9-7-12-18(15,16)2)8-6-13-19(20(22,23)24,21(25,26)27)29-30(3,4)5/h6,13-16H,7-12H2,1-5H3/t14?,15-,16+,18-/m1/s1 |
| InChIKey | YNDQREGGKFPTHH-YCXXCVGLSA-N |
| XLogP | 7.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|