C17H17F2NO2 — CID 57032986
N,N-difluoro-3-methoxy-2-(2-propan-2-ylphenyl)benzamide (PubChem CID 57032986) has the molecular formula C17H17F2NO2 and a molecular weight of 305.32 g/mol. Its IUPAC name is N,N-difluoro-3-methoxy-2-(2-propan-2-ylphenyl)benzamide.
| Compound Name | N,N-difluoro-3-methoxy-2-(2-propan-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 57032986 |
| Molecular Formula | C17H17F2NO2 |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N,N-difluoro-3-methoxy-2-(2-propan-2-ylphenyl)benzamide |
| SMILES | COc1cccc(C(=O)N(F)F)c1-c1ccccc1C(C)C |
| InChI | InChI=1S/C17H17F2NO2/c1-11(2)12-7-4-5-8-13(12)16-14(17(21)20(18)19)9-6-10-15(16)22-3/h4-11H,1-3H3 |
| InChIKey | HVAOFBUZGTZVBR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|