About CID 57033194
CID 57033194 (PubChem CID 57033194) has the molecular formula C18H24BN2O6
and a molecular weight of 375.21 g/mol.
Molecular Properties
| Compound Name | CID 57033194 |
| PubChem CID | 57033194 |
| Molecular Formula | C18H24BN2O6 |
| Molecular Weight | 375.21 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)n1cccc1O[B]Oc1cccn1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24BN2O6/c1-17(2,3)24-15(22)20-11-7-9-13(20)26-19-27-14-10-8-12-21(14)16(23)25-18(4,5)6/h7-12H,1-6H3 |
| InChIKey | SJBXJHSUVJTEJP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 80.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.21 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 57033194 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57033194?
The IUPAC name of CID 57033194 (CID 57033194) is not available.
What is the SMILES notation for CID 57033194?
The canonical SMILES for CID 57033194 is CC(C)(C)OC(=O)n1cccc1O[B]Oc1cccn1C(=O)OC(C)(C)C.
What is the InChIKey of CID 57033194?
The InChIKey is SJBXJHSUVJTEJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24BN2O6/c1-17(2,3)24-15(22)20-11-7-9-13(20)26-19-27-14-10-8-12-21(14)16(23)25-18(4,5)6/h7-12H,1-6H3.
What are the key properties of CID 57033194?
CID 57033194 has a molecular weight of 375.21 g/mol, XLogP of 3.85, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57033194 is sourced from PubChem (CID 57033194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).