About 5-propyl-1H-1,2,4-triazole-3-carboxamide
5-propyl-1H-1,2,4-triazole-3-carboxamide (PubChem CID 57033281) has the molecular formula C6H10N4O
and a molecular weight of 154.17 g/mol. Its IUPAC name is 5-propyl-1H-1,2,4-triazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-propyl-1H-1,2,4-triazole-3-carboxamide |
| PubChem CID | 57033281 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 5-propyl-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CCCc1nc(C(N)=O)n[nH]1 |
| InChI | InChI=1S/C6H10N4O/c1-2-3-4-8-6(5(7)11)10-9-4/h2-3H2,1H3,(H2,7,11)(H,8,9,10) |
| InChIKey | WDYYCTTUVSQQII-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-propyl-1H-1,2,4-triazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propyl-1H-1,2,4-triazole-3-carboxamide?
The IUPAC name of 5-propyl-1H-1,2,4-triazole-3-carboxamide (CID 57033281) is 5-propyl-1H-1,2,4-triazole-3-carboxamide.
What is the SMILES notation for 5-propyl-1H-1,2,4-triazole-3-carboxamide?
The canonical SMILES for 5-propyl-1H-1,2,4-triazole-3-carboxamide is CCCc1nc(C(N)=O)n[nH]1.
What is the InChIKey of 5-propyl-1H-1,2,4-triazole-3-carboxamide?
The InChIKey is WDYYCTTUVSQQII-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O/c1-2-3-4-8-6(5(7)11)10-9-4/h2-3H2,1H3,(H2,7,11)(H,8,9,10).
What are the key properties of 5-propyl-1H-1,2,4-triazole-3-carboxamide?
5-propyl-1H-1,2,4-triazole-3-carboxamide has a molecular weight of 154.17 g/mol, XLogP of -0.14, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propyl-1H-1,2,4-triazole-3-carboxamide is sourced from PubChem (CID 57033281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).