C16H22N4O4 — CID 57033436
tert-butyl 2-carbamimidoyl-6-[(3S,5R)-5-(2-oxoethyl)-1,2-oxazolidin-3-yl]pyridine-3-carboxylate (PubChem CID 57033436) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is tert-butyl 2-carbamimidoyl-6-[(3S,5R)-5-(2-oxoethyl)-1,2-oxazolidin-3-yl]pyridine-3-carboxylate.
| Compound Name | tert-butyl 2-carbamimidoyl-6-[(3S,5R)-5-(2-oxoethyl)-1,2-oxazolidin-3-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 57033436 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | tert-butyl 2-carbamimidoyl-6-[(3S,5R)-5-(2-oxoethyl)-1,2-oxazolidin-3-yl]pyridine-3-carboxylate |
| SMILES | [H]/N=C(\N)c1nc([C@@H]2C[C@H](CC=O)ON2)ccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22N4O4/c1-16(2,3)23-15(22)10-4-5-11(19-13(10)14(17)18)12-8-9(6-7-21)24-20-12/h4-5,7,9,12,20H,6,8H2,1-3H3,(H3,17,18)/t9-,12-/m0/s1 |
| InChIKey | WSDVIWNWYQGIOE-CABZTGNLSA-N |
| XLogP | 1.24 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|