About [1,3]diazepino[1,2-b]isoindol-7-one
[1,3]diazepino[1,2-b]isoindol-7-one (PubChem CID 57033630) has the molecular formula C12H8N2O
and a molecular weight of 196.21 g/mol. Its IUPAC name is [1,3]diazepino[1,2-b]isoindol-7-one.
Molecular Properties
| Compound Name | [1,3]diazepino[1,2-b]isoindol-7-one |
| PubChem CID | 57033630 |
| Molecular Formula | C12H8N2O |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | [1,3]diazepino[1,2-b]isoindol-7-one |
| SMILES | O=c1c2ccccc2c2nccccn1-2 |
| InChI | InChI=1S/C12H8N2O/c15-12-10-6-2-1-5-9(10)11-13-7-3-4-8-14(11)12/h1-8H |
| InChIKey | KRHWSXNKOCXJAN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1,3]diazepino[1,2-b]isoindol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3]diazepino[1,2-b]isoindol-7-one?
The IUPAC name of [1,3]diazepino[1,2-b]isoindol-7-one (CID 57033630) is [1,3]diazepino[1,2-b]isoindol-7-one.
What is the SMILES notation for [1,3]diazepino[1,2-b]isoindol-7-one?
The canonical SMILES for [1,3]diazepino[1,2-b]isoindol-7-one is O=c1c2ccccc2c2nccccn1-2.
What is the InChIKey of [1,3]diazepino[1,2-b]isoindol-7-one?
The InChIKey is KRHWSXNKOCXJAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O/c15-12-10-6-2-1-5-9(10)11-13-7-3-4-8-14(11)12/h1-8H.
What are the key properties of [1,3]diazepino[1,2-b]isoindol-7-one?
[1,3]diazepino[1,2-b]isoindol-7-one has a molecular weight of 196.21 g/mol, XLogP of 1.82, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3]diazepino[1,2-b]isoindol-7-one is sourced from PubChem (CID 57033630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).