About 2-(4-chloro-3-nitrophenyl)-3,5-diphenylpyridine
2-(4-chloro-3-nitrophenyl)-3,5-diphenylpyridine (PubChem CID 57034038) has the molecular formula C23H15ClN2O2
and a molecular weight of 386.84 g/mol. Its IUPAC name is 2-(4-chloro-3-nitrophenyl)-3,5-diphenylpyridine.
Molecular Properties
| Compound Name | 2-(4-chloro-3-nitrophenyl)-3,5-diphenylpyridine |
| PubChem CID | 57034038 |
| Molecular Formula | C23H15ClN2O2 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-(4-chloro-3-nitrophenyl)-3,5-diphenylpyridine |
| SMILES | O=[N+]([O-])c1cc(-c2ncc(-c3ccccc3)cc2-c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C23H15ClN2O2/c24-21-12-11-18(14-22(21)26(27)28)23-20(17-9-5-2-6-10-17)13-19(15-25-23)16-7-3-1-4-8-16/h1-15H |
| InChIKey | RIWGZFBWKXXSLM-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chloro-3-nitrophenyl)-3,5-diphenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-3-nitrophenyl)-3,5-diphenylpyridine?
The IUPAC name of 2-(4-chloro-3-nitrophenyl)-3,5-diphenylpyridine (CID 57034038) is 2-(4-chloro-3-nitrophenyl)-3,5-diphenylpyridine.
What is the SMILES notation for 2-(4-chloro-3-nitrophenyl)-3,5-diphenylpyridine?
The canonical SMILES for 2-(4-chloro-3-nitrophenyl)-3,5-diphenylpyridine is O=[N+]([O-])c1cc(-c2ncc(-c3ccccc3)cc2-c2ccccc2)ccc1Cl.
What is the InChIKey of 2-(4-chloro-3-nitrophenyl)-3,5-diphenylpyridine?
The InChIKey is RIWGZFBWKXXSLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15ClN2O2/c24-21-12-11-18(14-22(21)26(27)28)23-20(17-9-5-2-6-10-17)13-19(15-25-23)16-7-3-1-4-8-16/h1-15H.
What are the key properties of 2-(4-chloro-3-nitrophenyl)-3,5-diphenylpyridine?
2-(4-chloro-3-nitrophenyl)-3,5-diphenylpyridine has a molecular weight of 386.84 g/mol, XLogP of 6.64, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-3-nitrophenyl)-3,5-diphenylpyridine is sourced from PubChem (CID 57034038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).