C31H62N3S+3 — CID 57034173
1,1,3,3-tetrabutyl-5,5-dicyclohexyl-1,3,5-triazinane-1,3,5-triium-2-thione (PubChem CID 57034173) has the molecular formula C31H62N3S+3 and a molecular weight of 508.93 g/mol. Its IUPAC name is 1,1,3,3-tetrabutyl-5,5-dicyclohexyl-1,3,5-triazinane-1,3,5-triium-2-thione.
| Compound Name | 1,1,3,3-tetrabutyl-5,5-dicyclohexyl-1,3,5-triazinane-1,3,5-triium-2-thione |
|---|---|
| PubChem CID | 57034173 |
| Molecular Formula | C31H62N3S+3 |
| Molecular Weight | 508.93 g/mol |
| Exact Mass | 508.46 |
| IUPAC Name | 1,1,3,3-tetrabutyl-5,5-dicyclohexyl-1,3,5-triazinane-1,3,5-triium-2-thione |
| SMILES | CCCC[N+]1(CCCC)C[N+](C2CCCCC2)(C2CCCCC2)C[N+](CCCC)(CCCC)C1=S |
| InChI | InChI=1S/C31H62N3S/c1-5-9-23-32(24-10-6-2)27-34(29-19-15-13-16-20-29,30-21-17-14-18-22-30)28-33(31(32)35,25-11-7-3)26-12-8-4/h29-30H,5-28H2,1-4H3/q+3 |
| InChIKey | UYKPXXWJYAFWJU-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.93 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|